How to prove compound angle formula of trigonometry | prove sin(A+B) = sinA.cosB + sinB.cosA and more formulae | Knowledge of Physics

Being straight to the point:

Suppose,

A , B and C are  given angles. Then angles of the form A+B, A-B, A+B+C  and  A-B-C which are formed by addition or subtraction of two or more angles are called compound angles. The formula relating the compound angle with single angles is called compound angle formula.

Trigonometric Compound Angle Formulae: 

  1. sin(A+B) = sinA cosB + sinB cosA
  2. sin(A-B) = sinA cosB - sinB cosA
  3. cos(A+B) = cosA cosB - sinA sinB 
  4. cos(A-B) = cosA cosB + sinA sinB
  5. tan(A+B) = tanA+tanB1-tanAtanB
  6. tan(A-B) = tanA-tanB1+tanAtanB
  7. cot(A+B) = cotAcotB-1cotA+cotB
  8. cot(A-B) = cotAcotB+1-cotA+cotB

Proof of Compound angle Formulae:

1. Proving cos(A-B) = cosA cosB + sinA sinB




Fig.1 Unit circle in X-Y plane to prove cos(A-B) = cosA cosB + sinA sinB.



Consider a unit circle with its center at origin O(0,0) of X-Y co-ordinate system. Take two points P and Q on the circumference of the circle and join them to origin O, so that we have two vectors OP and OQ, as shown in fig.1.

OP makes an angle A with OX. That is, POX=A.

OQ makes an angle B with OX. That is QOX=B.

Therefore, the angle between OP and OQ is,

POQ=POX-QOX=A-B -------(1)

Resolving OP and OQ along X and Y axis, we get

Component of OP along X-axis = |OP|cosA

Component of OP along Y-axis = |OP|sinA 

Similarly,
Component of OQ along X-axis = |OQ|cosB

Component of OQ along Y-axis = |OQ|cosB

 So, the coordinates of point P and Q become, P(|OP|cosA, |OP|sinA ) and Q(|OQ|cosB, |OQ|sinB ) respectively.

Since, the circle is a unit circle, its radius is equal to 1. The line OP and OQ represent radius of the circle, as shown in fig.1. This implies that the magnitude of vectors OP and OQ equals to 1. That is, 

|OP| = 1
|OQ| = 1

Then two coordinates become P(cosA, sinA ) and Q(cosB, sinB ).

Now the vectors OP and OQ can be written as

OP = x-component i +  y-compent j = cosA i + sinA j

OQ = x-component i +  y-compent j = cosB i + sinB j

Where i and j are unit vectors along X and Y axis respectively.

Now the cosine or cos of the angle between two vectors OP and OQ is,

cos(POQ)=OP .OQ|OP||OQ|

or, cos(A-B)=(cos(A)i+sin(A)j).(cos(B)i+sin(B)j)1×1

or, cos(A-B) = (cosA i + sinA j) . (cosB i + sinB j)

Multiplying the like terms of vectors i and j because i.i=1, j.j=1 but i.j=0, we get

cos(A-B) = cosA i . cosB i + sinA j . sinB j

or, cos(A-B) = cosA cosB (i.i) + sinA sinB (j.j)

or, cos(A-B) = cosA cosB + sinA sinB.

cos(A-B) = cosA cosB + sinA sinB. ------(2)
This proves the formula for cos(A-B).



2. Proving formula cos(A+B) = cosA cosB - sinA sinB.

To prove this formula, replace B from equation (2) by -B. That is,

cos(A-(-B)) = cosA cos(-B) + sinA sin(-B)

But cos(-B) = cosB and sin(-B) = sinB, so

or, cos(A+B) = cosA cosB - sinA sinB

cos(A+B) = cosA cosB - sinA sinB -------(3)
This proves the formula for cos(A+B).

3. Proving the formula for sin(A+B)

sin(A+B) = cos(900 - (A+B))

or, sin(A+B) = cos((900 - A) - B)

Considering (900 - A) as A and using (2), we have

sin(A+B) = cos(900-A) cosB + sin(900-A) sinB

or, sin(A+B) = sinA cosB + sinB cosA

sin(A+B) = sinA cosB + sinB cosA --------(4)
This proves the formula for sin(A+B).


4. Proving the formula for sin(A-B)

Replacing B in (4) by -B, we get

sin(A-B) = sinA cosB - sinB cosA -------(5)

Or you can also get this relation by

sin(A-B) = cos(900 - (A-B)) and  use the formula for cos(A+B) as we proved formula for sin(A+B). Try it yourself.


5. Proving the formula for tan(A+B)
We know,
tanθ=sinθcosθ, So

tan(A+B)=sin(A+B)cos(A+B)

Using the formula given by equations (3) and (4), 

tan(A+B)=sinAcosA+sinBcosAcosAcosB-sinAsinB

Dividing denominator and numerator by cosA cosB,
 
tan(A+B)=sinAcosB+sinBcosAcosAcosBcosAcosB-sinAsinBcosAcosB

tan(A+B)=sinAcosBcosAcosB+sinBcosAcosAcosBcosAcosBcosAcosB-sinAsinBcosAcosB

tan(A+B)=sinAcosA+sinBcosB1-sinAcosAsinBcosB

tan(A+B)=tanA+tanB1-tanAtanB

tan(A+B)=tanA+tanB1-tanAtanB -----(6).
This proves formula for tan(A+B).


6. Proving the formula for tan(A-B)

Replacing B in (6) by -B, we get

tan(A-B)=tanA-tanB1+tanAtanB

Or,  you can also prove it by using formula given by equations (2) and (5). Try it yourself. Follow the steps as we used for proving the formula for tan(A+B).  

tan(A-B)=tanA-tanB1+tanAtanB ------(7)
This proves the formula for tan(A-B).


7. Proving the formula for cot(A+B)

We know,
cotθ=cosθsinθ, so

cot(A+B)=cos(A+B)sin(A+B)

Using the formula given by equations (3) and (4), we have

cot(A+B)=cosAcosB-sinAsinBsinAcosB+sinBcosA

Dividing denominator and numerator by sinA sinB, we get

cot(A+B)=cosAcosB-sinAsinBsinAsinBsinAcosB+sinBcosAsinAsinB

cot(A+B)=cosAcosBsinAsinB-sinAsinBsinAsinBsinAcosBsinAsinB+sinBcosAsinAsinB

cot(A+B)=cosAsinAcosBsinB-1cosBsinB+cosAsinA

cot(A+B)=cotAcotB-1cotB+cotA

cot(A+B)=cotBcotA-1cotB+cotA -------(8)
This proves the formula for cot(A+B).

8. Proving the formula for cot(A-B)

To get formula for cot(A-B), replace B in equation by -B, then
cot(A-B)=cot(-B)cotA-1cot(-B)+cotA

or, cot(A-B)=-cotBcotA-1-cotB+cotA

or, cot(A-B)=-(cotBcotA+1)-(cotB-cotA)

cot(A-B)=cotBcotA+1cotB-cotA ----(9)
This proves the formula for cot(A-B).

You can also prove formula given by equation (9) by using  equations (2) and (5), by following the steps as we did for proving the formula for cot(A+B).


Some rules of Angle conversion:

  1. sin(-θ) = - sinθ
  2. cos(-θ) = cosθ
  3. tan(-θ) = sin(-θ)cos(-θ)=-sinθcosθ=-tanθ
  4. cot(-θ) = cos(-θ)sin(-θ)=cosθ-sinθ=-cotθ
  5. sec(-θ)=1cos(-θ)=1cosθ=secθ
  6. cosec(-θ) = 1sin(-θ)=1-sinθ = -cosecθ.
For Example:

1. Find the value of sin(-150).
Here,
sin(-150)
= sin(300-450)
= sin300cos450-sin450cos300 ----(i)

We have, sin300=12and cos300=32 and sin450=cos450=12.
Using these values,

sin(-150)=1212-1232
sin(-150)=1-322

As 3>1,

sin(-150)=-3-122

sin(-150)=-3-122.
This gives the rquired value.

Also from (i),

sin(-150)=sin300cos450-sin450cos300

or, sin(-150)=-(sin450cos300-sin300cos450)
or, sin(-150)=-sin(450-300)
or, sin(-150)=-sin150

sin(-150)=-sin150.//


2. If A+B+C=π, then prove that

a.) tanA + tanB + tanC = tanA tanB tanC

b.) cotA2 + cotB2 + cotC2 =  cotA2 cotB2 cotC2

c.) cotA cotB + cotB cotC + cotC cotA = 1

Solution:
Given,
A + B + C =π
A+B = π - C ------(i)

a.) To prove part (a), take tan on both sides of (i),

tan(A+B) = tan(π - C)

or, tanA+tanB1-tanAtanB=-tanC

or, tanA + tanB = -tanC (1 - tanA tanB)

or, tanA + tanB = -tanC + tanA tanB tanC

or, tanA + tanB + tanC = tanA tanB tanC

tanA + tanB + tanC = tanA tanB tanC.
This proves the first part.

b.)  To prove second part, divide both of (i) by 2,

A+B=π-C
A+B2=π-C2
Taking cot on both sides, we get
cot(A+B2)=cot(π-C2)
or, cot(A2+B2)=cot(π2-C2)
or, cotA2cotB2-1cotB2+cotA2=tanC2
or, cotA2cotB2-1=tanC2(cotB2+cotA2)
or, cotA2cotB2-1=1cotC2(cotB2+cotA2)
or, cotC2(cotA2cotB2-1)= (cotB2+cotA2)
or, cotA2cotB2cotC2-cotC2= cotB2+cotA2
or, cotA2+cotB2+cotC2= cotB2cotA2cotC2
cotA2+cotB2+cotC2= cotA2.cotB2.cotC2.
This proves the second part.

c.) To prove third part, take cot on both sides of (i),

cot(A+B) = cot(π - C)

or,  cotAcotB-1cotB+cotA=-cotC

or, cotA cotB -1 = - cotC (cotB + cotA)

or, cotA cotB - 1 = - cotB cotC - cotC cotA

or, cotA cotB + cotB cotC + cotC cotA = 1

cotA cotB + cotB cotC + cotC cotA = 1.
This proves the third part.
 
3.) Prove that: sin(A-450)=12(sinA-cosA)
Solution:
Taking Left Hand Side,
sin(A-450)

= sinAcos450-sin450cosA

But sin450=cos450=12, so

= sinA12-12cosA

= 12(sinA-cosA), which the right hand side.

sin(A-450)=12(sinA-cosA). Hence proved. 


Follow this site for more updates.


Comments

These posts may also be useful for you

top 3 websites for downloading research papers for free

plot graph in gnuplot from csv and data file | knowledge of physics

projectile motion in fortran | relation of angle of projection and horizontal range

NEB physics exam numerical problems with solutions for grade 12 students

how to plot 3D and parametric graphs in gnuplot | three dimensional plot in gnuplot software

how to create GIF animation in gnuplot | animation using gnuplot software

NEB board exam maths solved problems with proper solutions - available for free | short answered mathematics problems solved group A

NEB grade 11 and 12 maths exam MCQ solved problems | NEB mathematics MCQ solved problems

derivatives of trigonometric functions - sinx, cosx, tanx, cotx, secx, cosecx and so on.